C26H32N2O3S — CID 175101596
3-(4-phenyl-4-piperazin-1-ylcyclohexa-1,5-dien-1-yl)propyl 4-methylbenzenesulfonate (PubChem CID 175101596) has the molecular formula C26H32N2O3S and a molecular weight of 452.62 g/mol. Its IUPAC name is 3-(4-phenyl-4-piperazin-1-ylcyclohexa-1,5-dien-1-yl)propyl 4-methylbenzenesulfonate.
| Compound Name | 3-(4-phenyl-4-piperazin-1-ylcyclohexa-1,5-dien-1-yl)propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 175101596 |
| Molecular Formula | C26H32N2O3S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-(4-phenyl-4-piperazin-1-ylcyclohexa-1,5-dien-1-yl)propyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCC2=CCC(c3ccccc3)(N3CCNCC3)C=C2)cc1 |
| InChI | InChI=1S/C26H32N2O3S/c1-22-9-11-25(12-10-22)32(29,30)31-21-5-6-23-13-15-26(16-14-23,24-7-3-2-4-8-24)28-19-17-27-18-20-28/h2-4,7-15,27H,5-6,16-21H2,1H3 |
| InChIKey | UWNGYJNVXLCMIN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|