C7H20N2O4Si2 — CID 175103467
(5-methoxy-2,2-disilyloxypentyl)urea (PubChem CID 175103467) has the molecular formula C7H20N2O4Si2 and a molecular weight of 252.42 g/mol. Its IUPAC name is (5-methoxy-2,2-disilyloxypentyl)urea.
| Compound Name | (5-methoxy-2,2-disilyloxypentyl)urea |
|---|---|
| PubChem CID | 175103467 |
| Molecular Formula | C7H20N2O4Si2 |
| Molecular Weight | 252.42 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (5-methoxy-2,2-disilyloxypentyl)urea |
| SMILES | COCCCC(CNC(N)=O)(O[SiH3])O[SiH3] |
| InChI | InChI=1S/C7H20N2O4Si2/c1-11-4-2-3-7(12-14,13-15)5-9-6(8)10/h2-5H2,1,14-15H3,(H3,8,9,10) |
| InChIKey | MZBBZQHENZTBIP-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.42 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|