C8H5N3O2 — CID 175104512
5-pyrazin-2-yl-1,2-oxazole-3-carbaldehyde (PubChem CID 175104512) has the molecular formula C8H5N3O2 and a molecular weight of 175.15 g/mol. Its IUPAC name is 5-pyrazin-2-yl-1,2-oxazole-3-carbaldehyde.
| Compound Name | 5-pyrazin-2-yl-1,2-oxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 175104512 |
| Molecular Formula | C8H5N3O2 |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | 5-pyrazin-2-yl-1,2-oxazole-3-carbaldehyde |
| SMILES | O=Cc1cc(-c2cnccn2)on1 |
| InChI | InChI=1S/C8H5N3O2/c12-5-6-3-8(13-11-6)7-4-9-1-2-10-7/h1-5H |
| InChIKey | GMTFXJKRNSUFBN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|