C10H17NO3 — CID 175104689
2,3-dimethyl-2-[methyl(prop-2-enoyl)amino]butanoic acid (PubChem CID 175104689) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2,3-dimethyl-2-[methyl(prop-2-enoyl)amino]butanoic acid.
| Compound Name | 2,3-dimethyl-2-[methyl(prop-2-enoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 175104689 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 2,3-dimethyl-2-[methyl(prop-2-enoyl)amino]butanoic acid |
| SMILES | C=CC(=O)N(C)C(C)(C(=O)O)C(C)C |
| InChI | InChI=1S/C10H17NO3/c1-6-8(12)11(5)10(4,7(2)3)9(13)14/h6-7H,1H2,2-5H3,(H,13,14) |
| InChIKey | GOYVNFKEMXYUJE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|