C20H36N2O6 — CID 161196672
6-(dimethylamino)-2,2,5-trimethyl-6-oxohexanoic acid;N,N-dimethylprop-2-enamide;2-methylprop-2-enoic acid (PubChem CID 161196672) has the molecular formula C20H36N2O6 and a molecular weight of 400.52 g/mol. Its IUPAC name is 6-(dimethylamino)-2,2,5-trimethyl-6-oxohexanoic acid;N,N-dimethylprop-2-enamide;2-methylprop-2-enoic acid.
| Compound Name | 6-(dimethylamino)-2,2,5-trimethyl-6-oxohexanoic acid;N,N-dimethylprop-2-enamide;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 161196672 |
| Molecular Formula | C20H36N2O6 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 6-(dimethylamino)-2,2,5-trimethyl-6-oxohexanoic acid;N,N-dimethylprop-2-enamide;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=CC(=O)N(C)C.CC(CCC(C)(C)C(=O)O)C(=O)N(C)C |
| InChI | InChI=1S/C11H21NO3.C5H9NO.C4H6O2/c1-8(9(13)12(4)5)6-7-11(2,3)10(14)15;1-4-5(7)6(2)3;1-3(2)4(5)6/h8H,6-7H2,1-5H3,(H,14,15);4H,1H2,2-3H3;1H2,2H3,(H,5,6) |
| InChIKey | UUKZZNZLRVQROS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|