C11H12N6O — CID 175107747
4-prop-2-enoxy-3-(tetrazol-1-yl)benzenecarboximidamide (PubChem CID 175107747) has the molecular formula C11H12N6O and a molecular weight of 244.26 g/mol. Its IUPAC name is 4-prop-2-enoxy-3-(tetrazol-1-yl)benzenecarboximidamide.
| Compound Name | 4-prop-2-enoxy-3-(tetrazol-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 175107747 |
| Molecular Formula | C11H12N6O |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 4-prop-2-enoxy-3-(tetrazol-1-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCC=C)c(-n2cnnn2)c1 |
| InChI | InChI=1S/C11H12N6O/c1-2-5-18-10-4-3-8(11(12)13)6-9(10)17-7-14-15-16-17/h2-4,6-7H,1,5H2,(H3,12,13) |
| InChIKey | LPAQRKHJCCGUOM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|