C9H9ClNO4P — CID 175109184
[chloro(phosphoroso)amino] propanoate;7-oxabicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 175109184) has the molecular formula C9H9ClNO4P and a molecular weight of 261.60 g/mol. Its IUPAC name is [chloro(phosphoroso)amino] propanoate;7-oxabicyclo[4.1.0]hepta-1,3,5-triene.
| Compound Name | [chloro(phosphoroso)amino] propanoate;7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 175109184 |
| Molecular Formula | C9H9ClNO4P |
| Molecular Weight | 261.60 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | [chloro(phosphoroso)amino] propanoate;7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | CCC(=O)ON(Cl)P=O.c1ccc2c(c1)O2 |
| InChI | InChI=1S/C6H4O.C3H5ClNO3P/c1-2-4-6-5(3-1)7-6;1-2-3(6)8-5(4)9-7/h1-4H;2H2,1H3 |
| InChIKey | GVXJWUUPDRKDQU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 59.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|