C25H21NO — CID 175114549
1H-1-benzazepine;1,3-diphenylprop-2-en-1-one (PubChem CID 175114549) has the molecular formula C25H21NO and a molecular weight of 351.45 g/mol. Its IUPAC name is 1H-1-benzazepine;1,3-diphenylprop-2-en-1-one.
| Compound Name | 1H-1-benzazepine;1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 175114549 |
| Molecular Formula | C25H21NO |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1H-1-benzazepine;1,3-diphenylprop-2-en-1-one |
| SMILES | C1=CNc2ccccc2C=C1.O=C(C=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12O.C10H9N/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;1-2-7-10-9(5-1)6-3-4-8-11-10/h1-12H;1-8,11H |
| InChIKey | CORDIWVPEIOWBH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|