C21H29BrO2 — CID 175116212
3-(bromomethyl)-3,6-dibutoxy-6-phenylcyclohexa-1,4-diene (PubChem CID 175116212) has the molecular formula C21H29BrO2 and a molecular weight of 393.37 g/mol. Its IUPAC name is 3-(bromomethyl)-3,6-dibutoxy-6-phenylcyclohexa-1,4-diene.
| Compound Name | 3-(bromomethyl)-3,6-dibutoxy-6-phenylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 175116212 |
| Molecular Formula | C21H29BrO2 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 3-(bromomethyl)-3,6-dibutoxy-6-phenylcyclohexa-1,4-diene |
| SMILES | CCCCOC1(CBr)C=CC(OCCCC)(c2ccccc2)C=C1 |
| InChI | InChI=1S/C21H29BrO2/c1-3-5-16-23-20(18-22)12-14-21(15-13-20,24-17-6-4-2)19-10-8-7-9-11-19/h7-15H,3-6,16-18H2,1-2H3 |
| InChIKey | RTPOTMHPPPRPNV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|