C16H18F2O — CID 67939834
3-butoxy-1,3-difluoro-6-phenylcyclohexa-1,4-diene (PubChem CID 67939834) has the molecular formula C16H18F2O and a molecular weight of 264.31 g/mol. Its IUPAC name is 3-butoxy-1,3-difluoro-6-phenylcyclohexa-1,4-diene.
| Compound Name | 3-butoxy-1,3-difluoro-6-phenylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 67939834 |
| Molecular Formula | C16H18F2O |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-butoxy-1,3-difluoro-6-phenylcyclohexa-1,4-diene |
| SMILES | CCCCOC1(F)C=CC(c2ccccc2)C(F)=C1 |
| InChI | InChI=1S/C16H18F2O/c1-2-3-11-19-16(18)10-9-14(15(17)12-16)13-7-5-4-6-8-13/h4-10,12,14H,2-3,11H2,1H3 |
| InChIKey | VCPZVFYTQCDRFL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|