C16H22O14S2 — CID 175116568
bis[2-(2-sulfooxyethoxy)ethyl] benzene-1,3-dicarboxylate (PubChem CID 175116568) has the molecular formula C16H22O14S2 and a molecular weight of 502.47 g/mol. Its IUPAC name is bis[2-(2-sulfooxyethoxy)ethyl] benzene-1,3-dicarboxylate.
| Compound Name | bis[2-(2-sulfooxyethoxy)ethyl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 175116568 |
| Molecular Formula | C16H22O14S2 |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | bis[2-(2-sulfooxyethoxy)ethyl] benzene-1,3-dicarboxylate |
| SMILES | O=C(OCCOCCOS(=O)(=O)O)c1cccc(C(=O)OCCOCCOS(=O)(=O)O)c1 |
| InChI | InChI=1S/C16H22O14S2/c17-15(27-8-4-25-6-10-29-31(19,20)21)13-2-1-3-14(12-13)16(18)28-9-5-26-7-11-30-32(22,23)24/h1-3,12H,4-11H2,(H,19,20,21)(H,22,23,24) |
| InChIKey | IDUXNPQTNMIULG-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 198.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|