C28H22O4 — CID 175122390
(1-methylpyren-2-yl) 3-(2,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 175122390) has the molecular formula C28H22O4 and a molecular weight of 422.48 g/mol. Its IUPAC name is (1-methylpyren-2-yl) 3-(2,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (1-methylpyren-2-yl) 3-(2,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 175122390 |
| Molecular Formula | C28H22O4 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (1-methylpyren-2-yl) 3-(2,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(C=CC(=O)Oc2cc3ccc4cccc5ccc(c2C)c3c45)c1 |
| InChI | InChI=1S/C28H22O4/c1-17-23-12-9-19-6-4-5-18-7-8-21(28(23)27(18)19)16-25(17)32-26(29)14-10-20-15-22(30-2)11-13-24(20)31-3/h4-16H,1-3H3 |
| InChIKey | VVWOCDPPPBTZCK-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|