C17H16Cl2N2 — CID 175124362
6-amino-4-chloro-3-(2-chlorophenyl)-6-(2-methylprop-1-enyl)cyclohexa-2,4-diene-1-carbonitrile (PubChem CID 175124362) has the molecular formula C17H16Cl2N2 and a molecular weight of 319.24 g/mol. Its IUPAC name is 6-amino-4-chloro-3-(2-chlorophenyl)-6-(2-methylprop-1-enyl)cyclohexa-2,4-diene-1-carbonitrile.
| Compound Name | 6-amino-4-chloro-3-(2-chlorophenyl)-6-(2-methylprop-1-enyl)cyclohexa-2,4-diene-1-carbonitrile |
|---|---|
| PubChem CID | 175124362 |
| Molecular Formula | C17H16Cl2N2 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 6-amino-4-chloro-3-(2-chlorophenyl)-6-(2-methylprop-1-enyl)cyclohexa-2,4-diene-1-carbonitrile |
| SMILES | CC(C)=CC1(N)C=C(Cl)C(c2ccccc2Cl)=CC1C#N |
| InChI | InChI=1S/C17H16Cl2N2/c1-11(2)8-17(21)9-16(19)14(7-12(17)10-20)13-5-3-4-6-15(13)18/h3-9,12H,21H2,1-2H3 |
| InChIKey | KIDMYZMTUBCICE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|