About 1-isocyano-1,4-dimethyl-2H-naphthalene-2-carbonitrile
1-isocyano-1,4-dimethyl-2H-naphthalene-2-carbonitrile (PubChem CID 161168076) has the molecular formula C14H12N2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-isocyano-1,4-dimethyl-2H-naphthalene-2-carbonitrile.
Molecular Properties
| Compound Name | 1-isocyano-1,4-dimethyl-2H-naphthalene-2-carbonitrile |
| PubChem CID | 161168076 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-isocyano-1,4-dimethyl-2H-naphthalene-2-carbonitrile |
| SMILES | [C-]#[N+]C1(C)c2ccccc2C(C)=CC1C#N |
| InChI | InChI=1S/C14H12N2/c1-10-8-11(9-15)14(2,16-3)13-7-5-4-6-12(10)13/h4-8,11H,1-2H3 |
| InChIKey | FVVJRIKZWQEDEH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyano-1,4-dimethyl-2H-naphthalene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyano-1,4-dimethyl-2H-naphthalene-2-carbonitrile?
The IUPAC name of 1-isocyano-1,4-dimethyl-2H-naphthalene-2-carbonitrile (CID 161168076) is 1-isocyano-1,4-dimethyl-2H-naphthalene-2-carbonitrile.
What is the SMILES notation for 1-isocyano-1,4-dimethyl-2H-naphthalene-2-carbonitrile?
The canonical SMILES for 1-isocyano-1,4-dimethyl-2H-naphthalene-2-carbonitrile is [C-]#[N+]C1(C)c2ccccc2C(C)=CC1C#N.
What is the InChIKey of 1-isocyano-1,4-dimethyl-2H-naphthalene-2-carbonitrile?
The InChIKey is FVVJRIKZWQEDEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2/c1-10-8-11(9-15)14(2,16-3)13-7-5-4-6-12(10)13/h4-8,11H,1-2H3.
What are the key properties of 1-isocyano-1,4-dimethyl-2H-naphthalene-2-carbonitrile?
1-isocyano-1,4-dimethyl-2H-naphthalene-2-carbonitrile has a molecular weight of 208.26 g/mol, XLogP of 3.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyano-1,4-dimethyl-2H-naphthalene-2-carbonitrile is sourced from PubChem (CID 161168076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).