C15H13F4N3O — CID 175128084
2-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]morpholine (PubChem CID 175128084) has the molecular formula C15H13F4N3O and a molecular weight of 327.28 g/mol. Its IUPAC name is 2-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]morpholine.
| Compound Name | 2-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]morpholine |
|---|---|
| PubChem CID | 175128084 |
| Molecular Formula | C15H13F4N3O |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]morpholine |
| SMILES | Fc1cncc(-c2ccc(C3CNCCO3)c(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C15H13F4N3O/c16-10-5-9(6-21-7-10)12-2-1-11(13-8-20-3-4-23-13)14(22-12)15(17,18)19/h1-2,5-7,13,20H,3-4,8H2 |
| InChIKey | FBGIKULAJANUAL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |