About ethanethioylsulfanyl 2-ethanethioylsulfanylacetate
ethanethioylsulfanyl 2-ethanethioylsulfanylacetate (PubChem CID 175129120) has the molecular formula C6H8O2S4
and a molecular weight of 240.40 g/mol. Its IUPAC name is ethanethioylsulfanyl 2-ethanethioylsulfanylacetate.
Molecular Properties
| Compound Name | ethanethioylsulfanyl 2-ethanethioylsulfanylacetate |
| PubChem CID | 175129120 |
| Molecular Formula | C6H8O2S4 |
| Molecular Weight | 240.40 g/mol |
| Exact Mass | 239.94 |
| IUPAC Name | ethanethioylsulfanyl 2-ethanethioylsulfanylacetate |
| SMILES | CC(=S)SCC(=O)OSC(C)=S |
| InChI | InChI=1S/C6H8O2S4/c1-4(9)11-3-6(7)8-12-5(2)10/h3H2,1-2H3 |
| InChIKey | ZNKUCZDEDXKQHE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethanethioylsulfanyl 2-ethanethioylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanethioylsulfanyl 2-ethanethioylsulfanylacetate?
The IUPAC name of ethanethioylsulfanyl 2-ethanethioylsulfanylacetate (CID 175129120) is ethanethioylsulfanyl 2-ethanethioylsulfanylacetate.
What is the SMILES notation for ethanethioylsulfanyl 2-ethanethioylsulfanylacetate?
The canonical SMILES for ethanethioylsulfanyl 2-ethanethioylsulfanylacetate is CC(=S)SCC(=O)OSC(C)=S.
What is the InChIKey of ethanethioylsulfanyl 2-ethanethioylsulfanylacetate?
The InChIKey is ZNKUCZDEDXKQHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2S4/c1-4(9)11-3-6(7)8-12-5(2)10/h3H2,1-2H3.
What are the key properties of ethanethioylsulfanyl 2-ethanethioylsulfanylacetate?
ethanethioylsulfanyl 2-ethanethioylsulfanylacetate has a molecular weight of 240.40 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethanethioylsulfanyl 2-ethanethioylsulfanylacetate is sourced from PubChem (CID 175129120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).