About 3-ethanethioylsulfanylpropyl ethanedithioate;formaldehyde;methane
3-ethanethioylsulfanylpropyl ethanedithioate;formaldehyde;methane (PubChem CID 157267642) has the molecular formula C11H26OS4
and a molecular weight of 302.60 g/mol. Its IUPAC name is 3-ethanethioylsulfanylpropyl ethanedithioate;formaldehyde;methane.
Molecular Properties
| Compound Name | 3-ethanethioylsulfanylpropyl ethanedithioate;formaldehyde;methane |
| PubChem CID | 157267642 |
| Molecular Formula | C11H26OS4 |
| Molecular Weight | 302.60 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3-ethanethioylsulfanylpropyl ethanedithioate;formaldehyde;methane |
| SMILES | C.C.C.C=O.CC(=S)SCCCSC(C)=S |
| InChI | InChI=1S/C7H12S4.CH2O.3CH4/c1-6(8)10-4-3-5-11-7(2)9;1-2;;;/h3-5H2,1-2H3;1H2;3*1H4 |
| InChIKey | AYEIAFQUKCTDQN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethanethioylsulfanylpropyl ethanedithioate;formaldehyde;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethanethioylsulfanylpropyl ethanedithioate;formaldehyde;methane?
The IUPAC name of 3-ethanethioylsulfanylpropyl ethanedithioate;formaldehyde;methane (CID 157267642) is 3-ethanethioylsulfanylpropyl ethanedithioate;formaldehyde;methane.
What is the SMILES notation for 3-ethanethioylsulfanylpropyl ethanedithioate;formaldehyde;methane?
The canonical SMILES for 3-ethanethioylsulfanylpropyl ethanedithioate;formaldehyde;methane is C.C.C.C=O.CC(=S)SCCCSC(C)=S.
What is the InChIKey of 3-ethanethioylsulfanylpropyl ethanedithioate;formaldehyde;methane?
The InChIKey is AYEIAFQUKCTDQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12S4.CH2O.3CH4/c1-6(8)10-4-3-5-11-7(2)9;1-2;;;/h3-5H2,1-2H3;1H2;3*1H4.
What are the key properties of 3-ethanethioylsulfanylpropyl ethanedithioate;formaldehyde;methane?
3-ethanethioylsulfanylpropyl ethanedithioate;formaldehyde;methane has a molecular weight of 302.60 g/mol, XLogP of 5.26, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethanethioylsulfanylpropyl ethanedithioate;formaldehyde;methane is sourced from PubChem (CID 157267642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).