About 2-oxopropyl ethanedithioate
2-oxopropyl ethanedithioate (PubChem CID 89230036) has the molecular formula C5H8OS2
and a molecular weight of 148.25 g/mol. Its IUPAC name is 2-oxopropyl ethanedithioate.
Molecular Properties
| Compound Name | 2-oxopropyl ethanedithioate |
| PubChem CID | 89230036 |
| Molecular Formula | C5H8OS2 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.00 |
| IUPAC Name | 2-oxopropyl ethanedithioate |
| SMILES | CC(=O)CSC(C)=S |
| InChI | InChI=1S/C5H8OS2/c1-4(6)3-8-5(2)7/h3H2,1-2H3 |
| InChIKey | RJWWAXISHKKBFR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopropyl ethanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyl ethanedithioate?
The IUPAC name of 2-oxopropyl ethanedithioate (CID 89230036) is 2-oxopropyl ethanedithioate.
What is the SMILES notation for 2-oxopropyl ethanedithioate?
The canonical SMILES for 2-oxopropyl ethanedithioate is CC(=O)CSC(C)=S.
What is the InChIKey of 2-oxopropyl ethanedithioate?
The InChIKey is RJWWAXISHKKBFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8OS2/c1-4(6)3-8-5(2)7/h3H2,1-2H3.
What are the key properties of 2-oxopropyl ethanedithioate?
2-oxopropyl ethanedithioate has a molecular weight of 148.25 g/mol, XLogP of 1.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl ethanedithioate is sourced from PubChem (CID 89230036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).