About 2-indol-1-yldecanal
2-indol-1-yldecanal (PubChem CID 175134329) has the molecular formula C18H25NO
and a molecular weight of 271.40 g/mol. Its IUPAC name is 2-indol-1-yldecanal.
Molecular Properties
| Compound Name | 2-indol-1-yldecanal |
| PubChem CID | 175134329 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2-indol-1-yldecanal |
| SMILES | CCCCCCCCC(C=O)n1ccc2ccccc21 |
| InChI | InChI=1S/C18H25NO/c1-2-3-4-5-6-7-11-17(15-20)19-14-13-16-10-8-9-12-18(16)19/h8-10,12-15,17H,2-7,11H2,1H3 |
| InChIKey | KKGDHXIERWDEJA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-indol-1-yldecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-indol-1-yldecanal?
The IUPAC name of 2-indol-1-yldecanal (CID 175134329) is 2-indol-1-yldecanal.
What is the SMILES notation for 2-indol-1-yldecanal?
The canonical SMILES for 2-indol-1-yldecanal is CCCCCCCCC(C=O)n1ccc2ccccc21.
What is the InChIKey of 2-indol-1-yldecanal?
The InChIKey is KKGDHXIERWDEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO/c1-2-3-4-5-6-7-11-17(15-20)19-14-13-16-10-8-9-12-18(16)19/h8-10,12-15,17H,2-7,11H2,1H3.
What are the key properties of 2-indol-1-yldecanal?
2-indol-1-yldecanal has a molecular weight of 271.40 g/mol, XLogP of 5.13, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-indol-1-yldecanal is sourced from PubChem (CID 175134329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).