About butyl indol-1-yl carbonate
butyl indol-1-yl carbonate (PubChem CID 67701904) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is butyl indol-1-yl carbonate.
Molecular Properties
| Compound Name | butyl indol-1-yl carbonate |
| PubChem CID | 67701904 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | butyl indol-1-yl carbonate |
| SMILES | CCCCOC(=O)On1ccc2ccccc21 |
| InChI | InChI=1S/C13H15NO3/c1-2-3-10-16-13(15)17-14-9-8-11-6-4-5-7-12(11)14/h4-9H,2-3,10H2,1H3 |
| InChIKey | NNOBXSBEAGNVOQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl indol-1-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl indol-1-yl carbonate?
The IUPAC name of butyl indol-1-yl carbonate (CID 67701904) is butyl indol-1-yl carbonate.
What is the SMILES notation for butyl indol-1-yl carbonate?
The canonical SMILES for butyl indol-1-yl carbonate is CCCCOC(=O)On1ccc2ccccc21.
What is the InChIKey of butyl indol-1-yl carbonate?
The InChIKey is NNOBXSBEAGNVOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-2-3-10-16-13(15)17-14-9-8-11-6-4-5-7-12(11)14/h4-9H,2-3,10H2,1H3.
What are the key properties of butyl indol-1-yl carbonate?
butyl indol-1-yl carbonate has a molecular weight of 233.27 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl indol-1-yl carbonate is sourced from PubChem (CID 67701904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).