About indol-1-yl 2-bromo-2-methylpropanoate
indol-1-yl 2-bromo-2-methylpropanoate (PubChem CID 175398791) has the molecular formula C12H12BrNO2
and a molecular weight of 282.14 g/mol. Its IUPAC name is indol-1-yl 2-bromo-2-methylpropanoate.
Molecular Properties
| Compound Name | indol-1-yl 2-bromo-2-methylpropanoate |
| PubChem CID | 175398791 |
| Molecular Formula | C12H12BrNO2 |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | indol-1-yl 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)On1ccc2ccccc21 |
| InChI | InChI=1S/C12H12BrNO2/c1-12(2,13)11(15)16-14-8-7-9-5-3-4-6-10(9)14/h3-8H,1-2H3 |
| InChIKey | HKGOWYJTJSJRBB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze indol-1-yl 2-bromo-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indol-1-yl 2-bromo-2-methylpropanoate?
The IUPAC name of indol-1-yl 2-bromo-2-methylpropanoate (CID 175398791) is indol-1-yl 2-bromo-2-methylpropanoate.
What is the SMILES notation for indol-1-yl 2-bromo-2-methylpropanoate?
The canonical SMILES for indol-1-yl 2-bromo-2-methylpropanoate is CC(C)(Br)C(=O)On1ccc2ccccc21.
What is the InChIKey of indol-1-yl 2-bromo-2-methylpropanoate?
The InChIKey is HKGOWYJTJSJRBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrNO2/c1-12(2,13)11(15)16-14-8-7-9-5-3-4-6-10(9)14/h3-8H,1-2H3.
What are the key properties of indol-1-yl 2-bromo-2-methylpropanoate?
indol-1-yl 2-bromo-2-methylpropanoate has a molecular weight of 282.14 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for indol-1-yl 2-bromo-2-methylpropanoate is sourced from PubChem (CID 175398791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).