About diindol-1-yl carbonate
diindol-1-yl carbonate (PubChem CID 154640293) has the molecular formula C17H12N2O3
and a molecular weight of 292.29 g/mol. Its IUPAC name is diindol-1-yl carbonate.
Molecular Properties
| Compound Name | diindol-1-yl carbonate |
| PubChem CID | 154640293 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | diindol-1-yl carbonate |
| SMILES | O=C(On1ccc2ccccc21)On1ccc2ccccc21 |
| InChI | InChI=1S/C17H12N2O3/c20-17(21-18-11-9-13-5-1-3-7-15(13)18)22-19-12-10-14-6-2-4-8-16(14)19/h1-12H |
| InChIKey | SEYHZCDVXSUCAM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 45.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze diindol-1-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diindol-1-yl carbonate?
The IUPAC name of diindol-1-yl carbonate (CID 154640293) is diindol-1-yl carbonate.
What is the SMILES notation for diindol-1-yl carbonate?
The canonical SMILES for diindol-1-yl carbonate is O=C(On1ccc2ccccc21)On1ccc2ccccc21.
What is the InChIKey of diindol-1-yl carbonate?
The InChIKey is SEYHZCDVXSUCAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O3/c20-17(21-18-11-9-13-5-1-3-7-15(13)18)22-19-12-10-14-6-2-4-8-16(14)19/h1-12H.
What are the key properties of diindol-1-yl carbonate?
diindol-1-yl carbonate has a molecular weight of 292.29 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diindol-1-yl carbonate is sourced from PubChem (CID 154640293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).