About 1-(4-bromobutoxy)indole
1-(4-bromobutoxy)indole (PubChem CID 175976502) has the molecular formula C12H14BrNO
and a molecular weight of 268.15 g/mol. Its IUPAC name is 1-(4-bromobutoxy)indole.
Molecular Properties
| Compound Name | 1-(4-bromobutoxy)indole |
| PubChem CID | 175976502 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 1-(4-bromobutoxy)indole |
| SMILES | BrCCCCOn1ccc2ccccc21 |
| InChI | InChI=1S/C12H14BrNO/c13-8-3-4-10-15-14-9-7-11-5-1-2-6-12(11)14/h1-2,5-7,9H,3-4,8,10H2 |
| InChIKey | SZOHIMJVZRGNNF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromobutoxy)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromobutoxy)indole?
The IUPAC name of 1-(4-bromobutoxy)indole (CID 175976502) is 1-(4-bromobutoxy)indole.
What is the SMILES notation for 1-(4-bromobutoxy)indole?
The canonical SMILES for 1-(4-bromobutoxy)indole is BrCCCCOn1ccc2ccccc21.
What is the InChIKey of 1-(4-bromobutoxy)indole?
The InChIKey is SZOHIMJVZRGNNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrNO/c13-8-3-4-10-15-14-9-7-11-5-1-2-6-12(11)14/h1-2,5-7,9H,3-4,8,10H2.
What are the key properties of 1-(4-bromobutoxy)indole?
1-(4-bromobutoxy)indole has a molecular weight of 268.15 g/mol, XLogP of 3.24, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromobutoxy)indole is sourced from PubChem (CID 175976502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).