C13H10O — CID 175135621
1-phenylhepta-3,5-diyn-1-one (PubChem CID 175135621) has the molecular formula C13H10O and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-phenylhepta-3,5-diyn-1-one.
| Compound Name | 1-phenylhepta-3,5-diyn-1-one |
|---|---|
| PubChem CID | 175135621 |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 1-phenylhepta-3,5-diyn-1-one |
| SMILES | CC#CC#CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H10O/c1-2-3-4-8-11-13(14)12-9-6-5-7-10-12/h5-7,9-10H,11H2,1H3 |
| InChIKey | QGJGPFGYINXPOS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|