C26H21FO5 — CID 175142879
2-[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]-7-fluorochromen-4-one (PubChem CID 175142879) has the molecular formula C26H21FO5 and a molecular weight of 432.45 g/mol. Its IUPAC name is 2-[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]-7-fluorochromen-4-one.
| Compound Name | 2-[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]-7-fluorochromen-4-one |
|---|---|
| PubChem CID | 175142879 |
| Molecular Formula | C26H21FO5 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]-7-fluorochromen-4-one |
| SMILES | COc1ccc(C=Cc2cc(OC)cc(OC)c2-c2cc(=O)c3ccc(F)cc3o2)cc1 |
| InChI | InChI=1S/C26H21FO5/c1-29-19-9-5-16(6-10-19)4-7-17-12-20(30-2)14-24(31-3)26(17)25-15-22(28)21-11-8-18(27)13-23(21)32-25/h4-15H,1-3H3 |
| InChIKey | QUUKXPOJDXFDOD-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|