C30H30O7 — CID 175144248
2-[2-[2-(4-butoxyphenyl)ethenyl]-4,6-dimethoxyphenyl]-3-hydroxy-6-methoxychromen-4-one (PubChem CID 175144248) has the molecular formula C30H30O7 and a molecular weight of 502.56 g/mol. Its IUPAC name is 2-[2-[2-(4-butoxyphenyl)ethenyl]-4,6-dimethoxyphenyl]-3-hydroxy-6-methoxychromen-4-one.
| Compound Name | 2-[2-[2-(4-butoxyphenyl)ethenyl]-4,6-dimethoxyphenyl]-3-hydroxy-6-methoxychromen-4-one |
|---|---|
| PubChem CID | 175144248 |
| Molecular Formula | C30H30O7 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 2-[2-[2-(4-butoxyphenyl)ethenyl]-4,6-dimethoxyphenyl]-3-hydroxy-6-methoxychromen-4-one |
| SMILES | CCCCOc1ccc(C=Cc2cc(OC)cc(OC)c2-c2oc3ccc(OC)cc3c(=O)c2O)cc1 |
| InChI | InChI=1S/C30H30O7/c1-5-6-15-36-21-11-8-19(9-12-21)7-10-20-16-23(34-3)18-26(35-4)27(20)30-29(32)28(31)24-17-22(33-2)13-14-25(24)37-30/h7-14,16-18,32H,5-6,15H2,1-4H3 |
| InChIKey | XZAULKXSCPMNOP-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|