C27H36BNO5 — CID 175149177
[(2S)-2,4-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pent-4-en-2-yl] N-benzylcarbamate (PubChem CID 175149177) has the molecular formula C27H36BNO5 and a molecular weight of 465.40 g/mol. Its IUPAC name is [(2S)-2,4-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pent-4-en-2-yl] N-benzylcarbamate.
| Compound Name | [(2S)-2,4-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pent-4-en-2-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 175149177 |
| Molecular Formula | C27H36BNO5 |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | [(2S)-2,4-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pent-4-en-2-yl] N-benzylcarbamate |
| SMILES | C=C(C)C[C@@](C)(COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)OC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H36BNO5/c1-20(2)17-27(7,32-24(30)29-18-21-11-9-8-10-12-21)19-31-23-15-13-22(14-16-23)28-33-25(3,4)26(5,6)34-28/h8-16H,1,17-19H2,2-7H3,(H,29,30)/t27-/m0/s1 |
| InChIKey | WOINZYCHRXGFEL-MHZLTWQESA-N |
| XLogP | 5.02 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|