About sodium;(2-aminoethylamino) ethenesulfonate;hydride
sodium;(2-aminoethylamino) ethenesulfonate;hydride (PubChem CID 175151064) has the molecular formula C4H11N2NaO3S
and a molecular weight of 190.20 g/mol. Its IUPAC name is sodium;(2-aminoethylamino) ethenesulfonate;hydride.
Molecular Properties
| Compound Name | sodium;(2-aminoethylamino) ethenesulfonate;hydride |
| PubChem CID | 175151064 |
| Molecular Formula | C4H11N2NaO3S |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | sodium;(2-aminoethylamino) ethenesulfonate;hydride |
| SMILES | C=CS(=O)(=O)ONCCN.[H-].[Na+] |
| InChI | InChI=1S/C4H10N2O3S.Na.H/c1-2-10(7,8)9-6-4-3-5;;/h2,6H,1,3-5H2;;/q;+1;-1 |
| InChIKey | JZBHYUUDVBRJPC-UHFFFAOYSA-N |
| XLogP | -3.94 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;(2-aminoethylamino) ethenesulfonate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;(2-aminoethylamino) ethenesulfonate;hydride?
The IUPAC name of sodium;(2-aminoethylamino) ethenesulfonate;hydride (CID 175151064) is sodium;(2-aminoethylamino) ethenesulfonate;hydride.
What is the SMILES notation for sodium;(2-aminoethylamino) ethenesulfonate;hydride?
The canonical SMILES for sodium;(2-aminoethylamino) ethenesulfonate;hydride is C=CS(=O)(=O)ONCCN.[H-].[Na+].
What is the InChIKey of sodium;(2-aminoethylamino) ethenesulfonate;hydride?
The InChIKey is JZBHYUUDVBRJPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O3S.Na.H/c1-2-10(7,8)9-6-4-3-5;;/h2,6H,1,3-5H2;;/q;+1;-1.
What are the key properties of sodium;(2-aminoethylamino) ethenesulfonate;hydride?
sodium;(2-aminoethylamino) ethenesulfonate;hydride has a molecular weight of 190.20 g/mol, XLogP of -3.94, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;(2-aminoethylamino) ethenesulfonate;hydride is sourced from PubChem (CID 175151064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).