C14H16Cl2O — CID 175151715
6,8-dichlorospiro[2,3-dihydrochromene-4,1'-cyclohexane] (PubChem CID 175151715) has the molecular formula C14H16Cl2O and a molecular weight of 271.19 g/mol. Its IUPAC name is 6,8-dichlorospiro[2,3-dihydrochromene-4,1'-cyclohexane].
| Compound Name | 6,8-dichlorospiro[2,3-dihydrochromene-4,1'-cyclohexane] |
|---|---|
| PubChem CID | 175151715 |
| Molecular Formula | C14H16Cl2O |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 6,8-dichlorospiro[2,3-dihydrochromene-4,1'-cyclohexane] |
| SMILES | Clc1cc(Cl)c2c(c1)C1(CCCCC1)CCO2 |
| InChI | InChI=1S/C14H16Cl2O/c15-10-8-11-13(12(16)9-10)17-7-6-14(11)4-2-1-3-5-14/h8-9H,1-7H2 |
| InChIKey | WYUBHYCPHDPEOH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |