C18H22Cl2NO+ — CID 6934760
1-[(4aS)-5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl]piperidin-1-ium (PubChem CID 6934760) has the molecular formula C18H22Cl2NO+ and a molecular weight of 339.29 g/mol. Its IUPAC name is 1-[(4aS)-5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl]piperidin-1-ium.
| Compound Name | 1-[(4aS)-5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl]piperidin-1-ium |
|---|---|
| PubChem CID | 6934760 |
| Molecular Formula | C18H22Cl2NO+ |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 1-[(4aS)-5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl]piperidin-1-ium |
| SMILES | Clc1cc(Cl)c2c(c1)C=C1CCCC[C@]1([NH+]1CCCCC1)O2 |
| InChI | InChI=1S/C18H21Cl2NO/c19-15-11-13-10-14-6-2-3-7-18(14,21-8-4-1-5-9-21)22-17(13)16(20)12-15/h10-12H,1-9H2/p+1/t18-/m0/s1 |
| InChIKey | RTKAPRCEVJCYGI-SFHVURJKSA-O |
| XLogP | 4.11 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |