C21H19Cl2NO — CID 23906161
1-(5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl)-2,3-dihydroindole (PubChem CID 23906161) has the molecular formula C21H19Cl2NO and a molecular weight of 372.30 g/mol. Its IUPAC name is 1-(5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl)-2,3-dihydroindole.
| Compound Name | 1-(5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 23906161 |
| Molecular Formula | C21H19Cl2NO |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 1-(5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl)-2,3-dihydroindole |
| SMILES | Clc1cc(Cl)c2c(c1)C=C1CCCCC1(N1CCc3ccccc31)O2 |
| InChI | InChI=1S/C21H19Cl2NO/c22-17-12-15-11-16-6-3-4-9-21(16,25-20(15)18(23)13-17)24-10-8-14-5-1-2-7-19(14)24/h1-2,5,7,11-13H,3-4,6,8-10H2 |
| InChIKey | WSVHANQDMLVXSJ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |