C14H14FN — CID 22637900
1-(1-fluorocyclohexa-2,4-dien-1-yl)-2,3-dihydroindole (PubChem CID 22637900) has the molecular formula C14H14FN and a molecular weight of 215.27 g/mol. Its IUPAC name is 1-(1-fluorocyclohexa-2,4-dien-1-yl)-2,3-dihydroindole.
| Compound Name | 1-(1-fluorocyclohexa-2,4-dien-1-yl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 22637900 |
| Molecular Formula | C14H14FN |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 1-(1-fluorocyclohexa-2,4-dien-1-yl)-2,3-dihydroindole |
| SMILES | FC1(N2CCc3ccccc32)C=CC=CC1 |
| InChI | InChI=1S/C14H14FN/c15-14(9-4-1-5-10-14)16-11-8-12-6-2-3-7-13(12)16/h1-7,9H,8,10-11H2 |
| InChIKey | WUMHRAMZUZUQDV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|