C17H20Cl2NO2+ — CID 6941691
4-[(4aR)-5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl]morpholin-4-ium (PubChem CID 6941691) has the molecular formula C17H20Cl2NO2+ and a molecular weight of 341.26 g/mol. Its IUPAC name is 4-[(4aR)-5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl]morpholin-4-ium.
| Compound Name | 4-[(4aR)-5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl]morpholin-4-ium |
|---|---|
| PubChem CID | 6941691 |
| Molecular Formula | C17H20Cl2NO2+ |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 4-[(4aR)-5,7-dichloro-1,2,3,4-tetrahydroxanthen-4a-yl]morpholin-4-ium |
| SMILES | Clc1cc(Cl)c2c(c1)C=C1CCCC[C@@]1([NH+]1CCOCC1)O2 |
| InChI | InChI=1S/C17H19Cl2NO2/c18-14-10-12-9-13-3-1-2-4-17(13,20-5-7-21-8-6-20)22-16(12)15(19)11-14/h9-11H,1-8H2/p+1/t17-/m1/s1 |
| InChIKey | COSRWYZDVXYLOJ-QGZVFWFLSA-O |
| XLogP | 2.95 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |