About (7,9-dichloro-2,3-dihydro-1-benzoxepin-4-yl)-phenylmethanone
(7,9-dichloro-2,3-dihydro-1-benzoxepin-4-yl)-phenylmethanone (PubChem CID 73333671) has the molecular formula C17H12Cl2O2
and a molecular weight of 319.19 g/mol. Its IUPAC name is (7,9-dichloro-2,3-dihydro-1-benzoxepin-4-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (7,9-dichloro-2,3-dihydro-1-benzoxepin-4-yl)-phenylmethanone |
| PubChem CID | 73333671 |
| Molecular Formula | C17H12Cl2O2 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | (7,9-dichloro-2,3-dihydro-1-benzoxepin-4-yl)-phenylmethanone |
| SMILES | O=C(C1=Cc2cc(Cl)cc(Cl)c2OCC1)c1ccccc1 |
| InChI | InChI=1S/C17H12Cl2O2/c18-14-9-13-8-12(6-7-21-17(13)15(19)10-14)16(20)11-4-2-1-3-5-11/h1-5,8-10H,6-7H2 |
| InChIKey | WXYNQYXZLUVKGC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7,9-dichloro-2,3-dihydro-1-benzoxepin-4-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7,9-dichloro-2,3-dihydro-1-benzoxepin-4-yl)-phenylmethanone?
The IUPAC name of (7,9-dichloro-2,3-dihydro-1-benzoxepin-4-yl)-phenylmethanone (CID 73333671) is (7,9-dichloro-2,3-dihydro-1-benzoxepin-4-yl)-phenylmethanone.
What is the SMILES notation for (7,9-dichloro-2,3-dihydro-1-benzoxepin-4-yl)-phenylmethanone?
The canonical SMILES for (7,9-dichloro-2,3-dihydro-1-benzoxepin-4-yl)-phenylmethanone is O=C(C1=Cc2cc(Cl)cc(Cl)c2OCC1)c1ccccc1.
What is the InChIKey of (7,9-dichloro-2,3-dihydro-1-benzoxepin-4-yl)-phenylmethanone?
The InChIKey is WXYNQYXZLUVKGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl2O2/c18-14-9-13-8-12(6-7-21-17(13)15(19)10-14)16(20)11-4-2-1-3-5-11/h1-5,8-10H,6-7H2.
What are the key properties of (7,9-dichloro-2,3-dihydro-1-benzoxepin-4-yl)-phenylmethanone?
(7,9-dichloro-2,3-dihydro-1-benzoxepin-4-yl)-phenylmethanone has a molecular weight of 319.19 g/mol, XLogP of 5.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7,9-dichloro-2,3-dihydro-1-benzoxepin-4-yl)-phenylmethanone is sourced from PubChem (CID 73333671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).