C12H13Cl2NO2 — CID 82045909
6,8-dichlorospiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-ol (PubChem CID 82045909) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is 6,8-dichlorospiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-ol.
| Compound Name | 6,8-dichlorospiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-ol |
|---|---|
| PubChem CID | 82045909 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 6,8-dichlorospiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-ol |
| SMILES | OC1CC2(CCNC2)Oc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C12H13Cl2NO2/c13-7-3-8-10(16)5-12(1-2-15-6-12)17-11(8)9(14)4-7/h3-4,10,15-16H,1-2,5-6H2 |
| InChIKey | CMZKKAFKRAWITG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |