C30H33NO3 — CID 175161042
(16Z)-15-[3-(1,3-dihydroisoindol-2-yl)-3-oxopropyl]-16-(hydroxymethylidene)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one (PubChem CID 175161042) has the molecular formula C30H33NO3 and a molecular weight of 455.60 g/mol. Its IUPAC name is (16Z)-15-[3-(1,3-dihydroisoindol-2-yl)-3-oxopropyl]-16-(hydroxymethylidene)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (16Z)-15-[3-(1,3-dihydroisoindol-2-yl)-3-oxopropyl]-16-(hydroxymethylidene)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 175161042 |
| Molecular Formula | C30H33NO3 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | (16Z)-15-[3-(1,3-dihydroisoindol-2-yl)-3-oxopropyl]-16-(hydroxymethylidene)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CC12CCC3c4ccccc4CCC3C1C(CCC(=O)N1Cc3ccccc3C1)/C(=C/O)C2=O |
| InChI | InChI=1S/C30H33NO3/c1-30-15-14-23-22-9-5-4-6-19(22)10-11-24(23)28(30)25(26(18-32)29(30)34)12-13-27(33)31-16-20-7-2-3-8-21(20)17-31/h2-9,18,23-25,28,32H,10-17H2,1H3/b26-18- |
| InChIKey | VZKNXBWKCUNNPX-ITYLOYPMSA-N |
| XLogP | 5.71 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|