C22H28O — CID 154999207
(13S,15R)-15-but-3-enyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 154999207) has the molecular formula C22H28O and a molecular weight of 308.46 g/mol. Its IUPAC name is (13S,15R)-15-but-3-enyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (13S,15R)-15-but-3-enyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 154999207 |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | (13S,15R)-15-but-3-enyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C=CCCC1CC(=O)[C@@]2(C)CCC3c4ccccc4CCC3C12 |
| InChI | InChI=1S/C22H28O/c1-3-4-7-16-14-20(23)22(2)13-12-18-17-9-6-5-8-15(17)10-11-19(18)21(16)22/h3,5-6,8-9,16,18-19,21H,1,4,7,10-14H2,2H3/t16?,18?,19?,21?,22-/m1/s1 |
| InChIKey | HVIWGYUZNKONER-MNAVCZCDSA-N |
| XLogP | 5.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|