C31H42O4 — CID 144765073
ethane;3-[3-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanoic acid (PubChem CID 144765073) has the molecular formula C31H42O4 and a molecular weight of 478.67 g/mol. Its IUPAC name is ethane;3-[3-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanoic acid.
| Compound Name | ethane;3-[3-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanoic acid |
|---|---|
| PubChem CID | 144765073 |
| Molecular Formula | C31H42O4 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | ethane;3-[3-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanoic acid |
| SMILES | C=C/C(=C\C=C/C)COc1ccc2c(c1)CCC1C2CCC2(C)C(=O)CC(CCC(=O)O)C12.CC |
| InChI | InChI=1S/C29H36O4.C2H6/c1-4-6-7-19(5-2)18-33-22-10-12-23-20(16-22)8-11-25-24(23)14-15-29(3)26(30)17-21(28(25)29)9-13-27(31)32;1-2/h4-7,10,12,16,21,24-25,28H,2,8-9,11,13-15,17-18H2,1,3H3,(H,31,32);1-2H3/b6-4-,19-7+; |
| InChIKey | DQQJMWLPJLOIMW-MQEABKFBSA-N |
| XLogP | 7.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|