C11H24O6Si — CID 175163670
1,1,2-trimethoxy-5-(oxiran-2-ylmethoxy)-1-silylpentan-2-ol (PubChem CID 175163670) has the molecular formula C11H24O6Si and a molecular weight of 280.39 g/mol. Its IUPAC name is 1,1,2-trimethoxy-5-(oxiran-2-ylmethoxy)-1-silylpentan-2-ol.
| Compound Name | 1,1,2-trimethoxy-5-(oxiran-2-ylmethoxy)-1-silylpentan-2-ol |
|---|---|
| PubChem CID | 175163670 |
| Molecular Formula | C11H24O6Si |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1,1,2-trimethoxy-5-(oxiran-2-ylmethoxy)-1-silylpentan-2-ol |
| SMILES | COC(O)(CCCOCC1CO1)C([SiH3])(OC)OC |
| InChI | InChI=1S/C11H24O6Si/c1-13-10(12,11(18,14-2)15-3)5-4-6-16-7-9-8-17-9/h9,12H,4-8H2,1-3,18H3 |
| InChIKey | ZQNCYUFXNBCATO-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|