C21H20N2O3 — CID 175163770
N-(7-benzamido-4-oxohepta-2,5-dienyl)benzamide (PubChem CID 175163770) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(7-benzamido-4-oxohepta-2,5-dienyl)benzamide.
| Compound Name | N-(7-benzamido-4-oxohepta-2,5-dienyl)benzamide |
|---|---|
| PubChem CID | 175163770 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-(7-benzamido-4-oxohepta-2,5-dienyl)benzamide |
| SMILES | O=C(C=CCNC(=O)c1ccccc1)C=CCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O3/c24-19(13-7-15-22-20(25)17-9-3-1-4-10-17)14-8-16-23-21(26)18-11-5-2-6-12-18/h1-14H,15-16H2,(H,22,25)(H,23,26) |
| InChIKey | LFCZDGLPPHRIFB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|