C13H17ClN4O — CID 175168290
5-(piperidin-4-ylamino)-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde;hydrochloride (PubChem CID 175168290) has the molecular formula C13H17ClN4O and a molecular weight of 280.76 g/mol. Its IUPAC name is 5-(piperidin-4-ylamino)-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde;hydrochloride.
| Compound Name | 5-(piperidin-4-ylamino)-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde;hydrochloride |
|---|---|
| PubChem CID | 175168290 |
| Molecular Formula | C13H17ClN4O |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 5-(piperidin-4-ylamino)-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde;hydrochloride |
| SMILES | Cl.O=Cc1c[nH]c2ncc(NC3CCNCC3)cc12 |
| InChI | InChI=1S/C13H16N4O.ClH/c18-8-9-6-15-13-12(9)5-11(7-16-13)17-10-1-3-14-4-2-10;/h5-8,10,14,17H,1-4H2,(H,15,16);1H |
| InChIKey | JRCOREZLIWUUBL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|