C19H17N3O4 — CID 175171738
2-hydroxy-5-nitrobenzaldehyde;2-N-phenylbenzene-1,2-diamine (PubChem CID 175171738) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-hydroxy-5-nitrobenzaldehyde;2-N-phenylbenzene-1,2-diamine.
| Compound Name | 2-hydroxy-5-nitrobenzaldehyde;2-N-phenylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 175171738 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-hydroxy-5-nitrobenzaldehyde;2-N-phenylbenzene-1,2-diamine |
| SMILES | Nc1ccccc1Nc1ccccc1.O=Cc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C12H12N2.C7H5NO4/c13-11-8-4-5-9-12(11)14-10-6-2-1-3-7-10;9-4-5-3-6(8(11)12)1-2-7(5)10/h1-9,14H,13H2;1-4,10H |
| InChIKey | LALFADIRGARFQX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|