About benzoic acid;(4-methylphenyl) 2-cyanoprop-2-enoate
benzoic acid;(4-methylphenyl) 2-cyanoprop-2-enoate (PubChem CID 175173275) has the molecular formula C18H15NO4
and a molecular weight of 309.32 g/mol. Its IUPAC name is benzoic acid;(4-methylphenyl) 2-cyanoprop-2-enoate.
Molecular Properties
| Compound Name | benzoic acid;(4-methylphenyl) 2-cyanoprop-2-enoate |
| PubChem CID | 175173275 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | benzoic acid;(4-methylphenyl) 2-cyanoprop-2-enoate |
| SMILES | C=C(C#N)C(=O)Oc1ccc(C)cc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C11H9NO2.C7H6O2/c1-8-3-5-10(6-4-8)14-11(13)9(2)7-12;8-7(9)6-4-2-1-3-5-6/h3-6H,2H2,1H3;1-5H,(H,8,9) |
| InChIKey | VFOITZRDTTWYIN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;(4-methylphenyl) 2-cyanoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;(4-methylphenyl) 2-cyanoprop-2-enoate?
The IUPAC name of benzoic acid;(4-methylphenyl) 2-cyanoprop-2-enoate (CID 175173275) is benzoic acid;(4-methylphenyl) 2-cyanoprop-2-enoate.
What is the SMILES notation for benzoic acid;(4-methylphenyl) 2-cyanoprop-2-enoate?
The canonical SMILES for benzoic acid;(4-methylphenyl) 2-cyanoprop-2-enoate is C=C(C#N)C(=O)Oc1ccc(C)cc1.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;(4-methylphenyl) 2-cyanoprop-2-enoate?
The InChIKey is VFOITZRDTTWYIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2.C7H6O2/c1-8-3-5-10(6-4-8)14-11(13)9(2)7-12;8-7(9)6-4-2-1-3-5-6/h3-6H,2H2,1H3;1-5H,(H,8,9).
What are the key properties of benzoic acid;(4-methylphenyl) 2-cyanoprop-2-enoate?
benzoic acid;(4-methylphenyl) 2-cyanoprop-2-enoate has a molecular weight of 309.32 g/mol, XLogP of 3.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;(4-methylphenyl) 2-cyanoprop-2-enoate is sourced from PubChem (CID 175173275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).