C17H23N2NaO3 — CID 175176023
sodium;formic acid;2-(5-methyl-2-pentyl-1,6-dihydroindol-6-id-3-yl)acetamide (PubChem CID 175176023) has the molecular formula C17H23N2NaO3 and a molecular weight of 326.37 g/mol. Its IUPAC name is sodium;formic acid;2-(5-methyl-2-pentyl-1,6-dihydroindol-6-id-3-yl)acetamide.
| Compound Name | sodium;formic acid;2-(5-methyl-2-pentyl-1,6-dihydroindol-6-id-3-yl)acetamide |
|---|---|
| PubChem CID | 175176023 |
| Molecular Formula | C17H23N2NaO3 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | sodium;formic acid;2-(5-methyl-2-pentyl-1,6-dihydroindol-6-id-3-yl)acetamide |
| SMILES | CCCCCc1[nH]c2c[c-]c(C)cc2c1CC(N)=O.O=CO.[Na+] |
| InChI | InChI=1S/C16H21N2O.CH2O2.Na/c1-3-4-5-6-14-13(10-16(17)19)12-9-11(2)7-8-15(12)18-14;2-1-3;/h8-9,18H,3-6,10H2,1-2H3,(H2,17,19);1H,(H,2,3);/q-1;;+1 |
| InChIKey | BDZROWPAXMZXCV-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|