C27H26S5 — CID 175177834
2-[1-(1,2-dithiophen-2-ylethyl)-3,4-dithiophen-2-ylpentyl]thiophene (PubChem CID 175177834) has the molecular formula C27H26S5 and a molecular weight of 510.84 g/mol. Its IUPAC name is 2-[1-(1,2-dithiophen-2-ylethyl)-3,4-dithiophen-2-ylpentyl]thiophene.
| Compound Name | 2-[1-(1,2-dithiophen-2-ylethyl)-3,4-dithiophen-2-ylpentyl]thiophene |
|---|---|
| PubChem CID | 175177834 |
| Molecular Formula | C27H26S5 |
| Molecular Weight | 510.84 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | 2-[1-(1,2-dithiophen-2-ylethyl)-3,4-dithiophen-2-ylpentyl]thiophene |
| SMILES | CC(c1cccs1)C(CC(c1cccs1)C(Cc1cccs1)c1cccs1)c1cccs1 |
| InChI | InChI=1S/C27H26S5/c1-19(24-8-3-13-29-24)21(25-9-4-14-30-25)18-23(27-11-6-16-32-27)22(26-10-5-15-31-26)17-20-7-2-12-28-20/h2-16,19,21-23H,17-18H2,1H3 |
| InChIKey | RYFIGRQVXMIVAB-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.84 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |