C27H44N10O3S — CID 175177884
6-amino-2-[[2-[[2-[(2-amino-3-phenylpropanoyl)amino]-5-(diaminomethylideneamino)pentyl]amino]-3-(1,3-thiazol-4-yl)propanoyl]amino]hexanamide (PubChem CID 175177884) has the molecular formula C27H44N10O3S and a molecular weight of 588.78 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-3-phenylpropanoyl)amino]-5-(diaminomethylideneamino)pentyl]amino]-3-(1,3-thiazol-4-yl)propanoyl]amino]hexanamide.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-3-phenylpropanoyl)amino]-5-(diaminomethylideneamino)pentyl]amino]-3-(1,3-thiazol-4-yl)propanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 175177884 |
| Molecular Formula | C27H44N10O3S |
| Molecular Weight | 588.78 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-3-phenylpropanoyl)amino]-5-(diaminomethylideneamino)pentyl]amino]-3-(1,3-thiazol-4-yl)propanoyl]amino]hexanamide |
| SMILES | NCCCCC(NC(=O)C(Cc1cscn1)NCC(CCCN=C(N)N)NC(=O)C(N)Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C27H44N10O3S/c28-11-5-4-10-22(24(30)38)37-26(40)23(14-20-16-41-17-35-20)34-15-19(9-6-12-33-27(31)32)36-25(39)21(29)13-18-7-2-1-3-8-18/h1-3,7-8,16-17,19,21-23,34H,4-6,9-15,28-29H2,(H2,30,38)(H,36,39)(H,37,40)(H4,31,32,33) |
| InChIKey | UJORJRRXWKDHFG-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 242.65 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.78 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|