About O-(1-chloropropyl) carbamothioate
O-(1-chloropropyl) carbamothioate (PubChem CID 175179302) has the molecular formula C4H8ClNOS
and a molecular weight of 153.63 g/mol. Its IUPAC name is O-(1-chloropropyl) carbamothioate.
Molecular Properties
| Compound Name | O-(1-chloropropyl) carbamothioate |
| PubChem CID | 175179302 |
| Molecular Formula | C4H8ClNOS |
| Molecular Weight | 153.63 g/mol |
| Exact Mass | 153.00 |
| IUPAC Name | O-(1-chloropropyl) carbamothioate |
| SMILES | CCC(Cl)OC(N)=S |
| InChI | InChI=1S/C4H8ClNOS/c1-2-3(5)7-4(6)8/h3H,2H2,1H3,(H2,6,8) |
| InChIKey | NKDIXRANELTMAX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.63 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(1-chloropropyl) carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(1-chloropropyl) carbamothioate?
The IUPAC name of O-(1-chloropropyl) carbamothioate (CID 175179302) is O-(1-chloropropyl) carbamothioate.
What is the SMILES notation for O-(1-chloropropyl) carbamothioate?
The canonical SMILES for O-(1-chloropropyl) carbamothioate is CCC(Cl)OC(N)=S.
What is the InChIKey of O-(1-chloropropyl) carbamothioate?
The InChIKey is NKDIXRANELTMAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8ClNOS/c1-2-3(5)7-4(6)8/h3H,2H2,1H3,(H2,6,8).
What are the key properties of O-(1-chloropropyl) carbamothioate?
O-(1-chloropropyl) carbamothioate has a molecular weight of 153.63 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-(1-chloropropyl) carbamothioate is sourced from PubChem (CID 175179302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).