About (carbamothioylamino) 2-chlorobutanoate
(carbamothioylamino) 2-chlorobutanoate (PubChem CID 174728409) has the molecular formula C5H9ClN2O2S
and a molecular weight of 196.66 g/mol. Its IUPAC name is (carbamothioylamino) 2-chlorobutanoate.
Molecular Properties
| Compound Name | (carbamothioylamino) 2-chlorobutanoate |
| PubChem CID | 174728409 |
| Molecular Formula | C5H9ClN2O2S |
| Molecular Weight | 196.66 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | (carbamothioylamino) 2-chlorobutanoate |
| SMILES | CCC(Cl)C(=O)ONC(N)=S |
| InChI | InChI=1S/C5H9ClN2O2S/c1-2-3(6)4(9)10-8-5(7)11/h3H,2H2,1H3,(H3,7,8,11) |
| InChIKey | GBBCEIJWUJTZDP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.66 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (carbamothioylamino) 2-chlorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (carbamothioylamino) 2-chlorobutanoate?
The IUPAC name of (carbamothioylamino) 2-chlorobutanoate (CID 174728409) is (carbamothioylamino) 2-chlorobutanoate.
What is the SMILES notation for (carbamothioylamino) 2-chlorobutanoate?
The canonical SMILES for (carbamothioylamino) 2-chlorobutanoate is CCC(Cl)C(=O)ONC(N)=S.
What is the InChIKey of (carbamothioylamino) 2-chlorobutanoate?
The InChIKey is GBBCEIJWUJTZDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClN2O2S/c1-2-3(6)4(9)10-8-5(7)11/h3H,2H2,1H3,(H3,7,8,11).
What are the key properties of (carbamothioylamino) 2-chlorobutanoate?
(carbamothioylamino) 2-chlorobutanoate has a molecular weight of 196.66 g/mol, XLogP of 0.30, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (carbamothioylamino) 2-chlorobutanoate is sourced from PubChem (CID 174728409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).