C24H26ClFN2O4Si — CID 175182171
(4aR)-8-(2-chloro-6-hydroxyphenyl)-7-fluoro-9-(2-trimethylsilylethynyl)-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylic acid (PubChem CID 175182171) has the molecular formula C24H26ClFN2O4Si and a molecular weight of 489.02 g/mol. Its IUPAC name is (4aR)-8-(2-chloro-6-hydroxyphenyl)-7-fluoro-9-(2-trimethylsilylethynyl)-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylic acid.
| Compound Name | (4aR)-8-(2-chloro-6-hydroxyphenyl)-7-fluoro-9-(2-trimethylsilylethynyl)-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 175182171 |
| Molecular Formula | C24H26ClFN2O4Si |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | (4aR)-8-(2-chloro-6-hydroxyphenyl)-7-fluoro-9-(2-trimethylsilylethynyl)-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepine-3-carboxylic acid |
| SMILES | C[Si](C)(C)C#Cc1cc2c(c(F)c1-c1c(O)cccc1Cl)OC[C@H]1CN(C(=O)O)CCN1C2 |
| InChI | InChI=1S/C24H26ClFN2O4Si/c1-33(2,3)10-7-15-11-16-12-27-8-9-28(24(30)31)13-17(27)14-32-23(16)22(26)20(15)21-18(25)5-4-6-19(21)29/h4-6,11,17,29H,8-9,12-14H2,1-3H3,(H,30,31)/t17-/m1/s1 |
| InChIKey | MOCWOPUQFLQTGY-QGZVFWFLSA-N |
| XLogP | 4.64 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|