C24H29BClFN2O3Si — CID 164802238
[(4aR)-7-chloro-8-(2-fluoro-6-hydroxyphenyl)-9-(2-trimethylsilylethynyl)-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepin-3-yl]-methylborinic acid (PubChem CID 164802238) has the molecular formula C24H29BClFN2O3Si and a molecular weight of 486.86 g/mol. Its IUPAC name is [(4aR)-7-chloro-8-(2-fluoro-6-hydroxyphenyl)-9-(2-trimethylsilylethynyl)-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepin-3-yl]-methylborinic acid.
| Compound Name | [(4aR)-7-chloro-8-(2-fluoro-6-hydroxyphenyl)-9-(2-trimethylsilylethynyl)-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepin-3-yl]-methylborinic acid |
|---|---|
| PubChem CID | 164802238 |
| Molecular Formula | C24H29BClFN2O3Si |
| Molecular Weight | 486.86 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | [(4aR)-7-chloro-8-(2-fluoro-6-hydroxyphenyl)-9-(2-trimethylsilylethynyl)-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepin-3-yl]-methylborinic acid |
| SMILES | CB(O)N1CCN2Cc3cc(C#C[Si](C)(C)C)c(-c4c(O)cccc4F)c(Cl)c3OC[C@H]2C1 |
| InChI | InChI=1S/C24H29BClFN2O3Si/c1-25(31)29-10-9-28-13-17-12-16(8-11-33(2,3)4)21(22-19(27)6-5-7-20(22)30)23(26)24(17)32-15-18(28)14-29/h5-7,12,18,30-31H,9-10,13-15H2,1-4H3/t18-/m1/s1 |
| InChIKey | RNTVGWYIFJCCAK-GOSISDBHSA-N |
| XLogP | 4.07 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.86 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|